C10H11F3N6S — CID 72878520
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 72878520) has the molecular formula C10H11F3N6S and a molecular weight of 304.30 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 72878520 |
| Molecular Formula | C10H11F3N6S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1nc(SCCNc2ccnc(C(F)(F)F)n2)n[nH]1 |
| InChI | InChI=1S/C10H11F3N6S/c1-6-16-9(19-18-6)20-5-4-14-7-2-3-15-8(17-7)10(11,12)13/h2-3H,4-5H2,1H3,(H,14,15,17)(H,16,18,19) |
| InChIKey | YASZSSGPQFERCE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|