C20H20F3NO2 — CID 72878648
1-[3-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone (PubChem CID 72878648) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-[3-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 1-[3-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 72878648 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 1-[3-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidin-1-yl]-2-(3,4,5-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)c(F)c(F)c1)N1CCC(Cc2cccc(CO)c2)C1 |
| InChI | InChI=1S/C20H20F3NO2/c21-17-8-16(9-18(22)20(17)23)10-19(26)24-5-4-14(11-24)6-13-2-1-3-15(7-13)12-25/h1-3,7-9,14,25H,4-6,10-12H2 |
| InChIKey | IHGWIIYBGWWCOK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|