C20H31N3O2S — CID 72879083
(2S,4R)-1-(3-methylbut-2-enyl)-N-propan-2-yl-4-(3-thiophen-2-ylpropanoylamino)pyrrolidine-2-carboxamide (PubChem CID 72879083) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is (2S,4R)-1-(3-methylbut-2-enyl)-N-propan-2-yl-4-(3-thiophen-2-ylpropanoylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-(3-methylbut-2-enyl)-N-propan-2-yl-4-(3-thiophen-2-ylpropanoylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72879083 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (2S,4R)-1-(3-methylbut-2-enyl)-N-propan-2-yl-4-(3-thiophen-2-ylpropanoylamino)pyrrolidine-2-carboxamide |
| SMILES | CC(C)=CCN1C[C@H](NC(=O)CCc2cccs2)C[C@H]1C(=O)NC(C)C |
| InChI | InChI=1S/C20H31N3O2S/c1-14(2)9-10-23-13-16(12-18(23)20(25)21-15(3)4)22-19(24)8-7-17-6-5-11-26-17/h5-6,9,11,15-16,18H,7-8,10,12-13H2,1-4H3,(H,21,25)(H,22,24)/t16-,18+/m1/s1 |
| InChIKey | VUWZWGBTOFKXGM-AEFFLSMTSA-N |
| XLogP | 2.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|