About 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine
2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine (PubChem CID 72879774) has the molecular formula C13H22FN5O2S
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine.
Molecular Properties
| Compound Name | 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine |
| PubChem CID | 72879774 |
| Molecular Formula | C13H22FN5O2S |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine |
| SMILES | CC(C)[C@@H]1CN(c2ncc(F)cn2)C[C@H]1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H22FN5O2S/c1-9(2)11-7-19(13-15-5-10(14)6-16-13)8-12(11)17-22(20,21)18(3)4/h5-6,9,11-12,17H,7-8H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | JDOSJSOGIJIWEG-NWDGAFQWSA-N |
| XLogP | 0.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine?
The IUPAC name of 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine (CID 72879774) is 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine.
What is the SMILES notation for 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine?
The canonical SMILES for 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine is CC(C)[C@@H]1CN(c2ncc(F)cn2)C[C@H]1NS(=O)(=O)N(C)C.
What is the InChIKey of 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine?
The InChIKey is JDOSJSOGIJIWEG-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H22FN5O2S/c1-9(2)11-7-19(13-15-5-10(14)6-16-13)8-12(11)17-22(20,21)18(3)4/h5-6,9,11-12,17H,7-8H2,1-4H3/t11-,12+/m0/s1.
What are the key properties of 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine?
2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine has a molecular weight of 331.42 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4R)-3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidin-1-yl]-5-fluoropyrimidine is sourced from PubChem (CID 72879774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).