C13H16F3N3O — CID 72880151
[(3aS,6aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol (PubChem CID 72880151) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is [(3aS,6aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aS,6aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 72880151 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [(3aS,6aS)-2-[4-(trifluoromethyl)pyrimidin-2-yl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methanol |
| SMILES | OC[C@@]12CCC[C@@H]1CN(c1nccc(C(F)(F)F)n1)C2 |
| InChI | InChI=1S/C13H16F3N3O/c14-13(15,16)10-3-5-17-11(18-10)19-6-9-2-1-4-12(9,7-19)8-20/h3,5,9,20H,1-2,4,6-8H2/t9-,12+/m1/s1 |
| InChIKey | UATQKWXYVOHMBJ-SKDRFNHKSA-N |
| XLogP | 2.09 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |