C16H18N2OS2 — CID 7288016
(2S,7S)-7-methyl-2-(5-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7288016) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is (2S,7S)-7-methyl-2-(5-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-7-methyl-2-(5-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7288016 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2S,7S)-7-methyl-2-(5-methylthiophen-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc([C@H]2NC(=O)c3c(sc4c3CC[C@H](C)C4)N2)s1 |
| InChI | InChI=1S/C16H18N2OS2/c1-8-3-5-10-12(7-8)21-16-13(10)15(19)17-14(18-16)11-6-4-9(2)20-11/h4,6,8,14,18H,3,5,7H2,1-2H3,(H,17,19)/t8-,14-/m0/s1 |
| InChIKey | CXYAGORFWUVSEQ-RTHLEPHNSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |