About 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea
1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea (PubChem CID 72880341) has the molecular formula C15H20N4O3S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea.
Molecular Properties
| Compound Name | 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea |
| PubChem CID | 72880341 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea |
| SMILES | Cc1n[nH]c(C)c1CCNC(=O)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H20N4O3S/c1-10-14(11(2)19-18-10)8-9-16-15(20)17-12-4-6-13(7-5-12)23(3,21)22/h4-7H,8-9H2,1-3H3,(H,18,19)(H2,16,17,20) |
| InChIKey | CYMGUSQJSYREEH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea?
The IUPAC name of 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea (CID 72880341) is 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea.
What is the SMILES notation for 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea?
The canonical SMILES for 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea is Cc1n[nH]c(C)c1CCNC(=O)Nc1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea?
The InChIKey is CYMGUSQJSYREEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O3S/c1-10-14(11(2)19-18-10)8-9-16-15(20)17-12-4-6-13(7-5-12)23(3,21)22/h4-7H,8-9H2,1-3H3,(H,18,19)(H2,16,17,20).
What are the key properties of 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea?
1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea has a molecular weight of 336.42 g/mol, XLogP of 1.79, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-3-(4-methylsulfonylphenyl)urea is sourced from PubChem (CID 72880341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).