About (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol
(3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol (PubChem CID 72880563) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol.
Molecular Properties
| Compound Name | (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol |
| PubChem CID | 72880563 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol |
| SMILES | CN(C)c1cncc(N2CC[C@](C)(O)[C@@H](O)C2)n1 |
| InChI | InChI=1S/C12H20N4O2/c1-12(18)4-5-16(8-9(12)17)11-7-13-6-10(14-11)15(2)3/h6-7,9,17-18H,4-5,8H2,1-3H3/t9-,12-/m0/s1 |
| InChIKey | XCCUXIDZHMFHPE-CABZTGNLSA-N |
| XLogP | -0.14 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol?
The IUPAC name of (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol (CID 72880563) is (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol.
What is the SMILES notation for (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol?
The canonical SMILES for (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol is CN(C)c1cncc(N2CC[C@](C)(O)[C@@H](O)C2)n1.
What is the InChIKey of (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol?
The InChIKey is XCCUXIDZHMFHPE-CABZTGNLSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-12(18)4-5-16(8-9(12)17)11-7-13-6-10(14-11)15(2)3/h6-7,9,17-18H,4-5,8H2,1-3H3/t9-,12-/m0/s1.
What are the key properties of (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol?
(3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol has a molecular weight of 252.32 g/mol, XLogP of -0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-[6-(dimethylamino)pyrazin-2-yl]-4-methylpiperidine-3,4-diol is sourced from PubChem (CID 72880563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).