C20H28N2O — CID 72880607
8-cyclopentyl-1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 72880607) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 8-cyclopentyl-1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-cyclopentyl-1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 72880607 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 8-cyclopentyl-1-methyl-3-phenyl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | CN1C(=O)C(c2ccccc2)CC12CCN(C1CCCC1)CC2 |
| InChI | InChI=1S/C20H28N2O/c1-21-19(23)18(16-7-3-2-4-8-16)15-20(21)11-13-22(14-12-20)17-9-5-6-10-17/h2-4,7-8,17-18H,5-6,9-15H2,1H3 |
| InChIKey | OLEICBJXMFRULM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |