C18H25N5O3 — CID 72880731
1-methyl-4-(6-oxo-1H-pyrazine-3-carbonyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72880731) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-methyl-4-(6-oxo-1H-pyrazine-3-carbonyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1-methyl-4-(6-oxo-1H-pyrazine-3-carbonyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72880731 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-methyl-4-(6-oxo-1H-pyrazine-3-carbonyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CCC2(CCC1=O)CN(C(=O)c1c[nH]c(=O)cn1)CCN2C |
| InChI | InChI=1S/C18H25N5O3/c1-3-7-22-8-6-18(5-4-16(22)25)13-23(10-9-21(18)2)17(26)14-11-20-15(24)12-19-14/h3,11-12H,1,4-10,13H2,2H3,(H,20,24) |
| InChIKey | AYXVQORCHSWXNV-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|