C17H20N4O3S — CID 72881058
2-anilino-N-(1,1-dioxothian-4-yl)-N-methylpyrimidine-5-carboxamide (PubChem CID 72881058) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-anilino-N-(1,1-dioxothian-4-yl)-N-methylpyrimidine-5-carboxamide.
| Compound Name | 2-anilino-N-(1,1-dioxothian-4-yl)-N-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72881058 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-anilino-N-(1,1-dioxothian-4-yl)-N-methylpyrimidine-5-carboxamide |
| SMILES | CN(C(=O)c1cnc(Nc2ccccc2)nc1)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H20N4O3S/c1-21(15-7-9-25(23,24)10-8-15)16(22)13-11-18-17(19-12-13)20-14-5-3-2-4-6-14/h2-6,11-12,15H,7-10H2,1H3,(H,18,19,20) |
| InChIKey | JQHRHTTWFNIWEX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |