C16H24N4O4S — CID 72881104
N-[(3S,5S)-5-(ethylcarbamoyl)-1-(2-propylsulfanylacetyl)pyrrolidin-3-yl]-1,2-oxazole-5-carboxamide (PubChem CID 72881104) has the molecular formula C16H24N4O4S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[(3S,5S)-5-(ethylcarbamoyl)-1-(2-propylsulfanylacetyl)pyrrolidin-3-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(2-propylsulfanylacetyl)pyrrolidin-3-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 72881104 |
| Molecular Formula | C16H24N4O4S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N-[(3S,5S)-5-(ethylcarbamoyl)-1-(2-propylsulfanylacetyl)pyrrolidin-3-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CCCSCC(=O)N1C[C@@H](NC(=O)c2ccno2)C[C@H]1C(=O)NCC |
| InChI | InChI=1S/C16H24N4O4S/c1-3-7-25-10-14(21)20-9-11(8-12(20)15(22)17-4-2)19-16(23)13-5-6-18-24-13/h5-6,11-12H,3-4,7-10H2,1-2H3,(H,17,22)(H,19,23)/t11-,12-/m0/s1 |
| InChIKey | RBPUBFDEHZWERV-RYUDHWBXSA-N |
| XLogP | 0.65 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|