C21H33N3O2 — CID 72881292
2-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl-(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 72881292) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 2-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl-(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | 2-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl-(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 72881292 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 2-[[1-[(2-methylphenyl)methyl]piperidin-4-yl]methyl-(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | Cc1ccccc1CN1CCC(CN(CC(N)=O)CC2CCCO2)CC1 |
| InChI | InChI=1S/C21H33N3O2/c1-17-5-2-3-6-19(17)14-23-10-8-18(9-11-23)13-24(16-21(22)25)15-20-7-4-12-26-20/h2-3,5-6,18,20H,4,7-16H2,1H3,(H2,22,25) |
| InChIKey | FIIMILCFBSIRRV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |