C13H18N4OS — CID 72882163
N-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2-pyrazol-1-ylbutanamide (PubChem CID 72882163) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2-pyrazol-1-ylbutanamide.
| Compound Name | N-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 72882163 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(4-ethyl-1,3-thiazol-2-yl)methyl]-2-pyrazol-1-ylbutanamide |
| SMILES | CCc1csc(CNC(=O)C(CC)n2cccn2)n1 |
| InChI | InChI=1S/C13H18N4OS/c1-3-10-9-19-12(16-10)8-14-13(18)11(4-2)17-7-5-6-15-17/h5-7,9,11H,3-4,8H2,1-2H3,(H,14,18) |
| InChIKey | QTLLKWLMCQESCW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |