About 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one
5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one (PubChem CID 72882793) has the molecular formula C17H17F2N3O3
and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one |
| PubChem CID | 72882793 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc(COc2ccccc2)[nH]c1=O)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C17H17F2N3O3/c18-17(19)6-8-22(9-7-17)16(24)13-10-20-14(21-15(13)23)11-25-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H,20,21,23) |
| InChIKey | XLSFNZSDGBJLAF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one (CID 72882793) is 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one is O=C(c1cnc(COc2ccccc2)[nH]c1=O)N1CCC(F)(F)CC1.
What is the InChIKey of 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one?
The InChIKey is XLSFNZSDGBJLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N3O3/c18-17(19)6-8-22(9-7-17)16(24)13-10-20-14(21-15(13)23)11-25-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H,20,21,23).
What are the key properties of 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one?
5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one has a molecular weight of 349.34 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-difluoropiperidine-1-carbonyl)-2-(phenoxymethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 72882793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).