C24H32N4O — CID 72883751
3-[4-(dimethylamino)phenyl]-1-[(1S,5R)-3-(pyridin-3-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one (PubChem CID 72883751) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-[(1S,5R)-3-(pyridin-3-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-[(1S,5R)-3-(pyridin-3-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
|---|---|
| PubChem CID | 72883751 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-[(1S,5R)-3-(pyridin-3-ylmethyl)-3,6-diazabicyclo[3.2.2]nonan-6-yl]propan-1-one |
| SMILES | CN(C)c1ccc(CCC(=O)N2C[C@H]3CC[C@@H]2CN(Cc2cccnc2)C3)cc1 |
| InChI | InChI=1S/C24H32N4O/c1-26(2)22-9-5-19(6-10-22)8-12-24(29)28-17-21-7-11-23(28)18-27(16-21)15-20-4-3-13-25-14-20/h3-6,9-10,13-14,21,23H,7-8,11-12,15-18H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | HZCSNAGITBTHKY-JTHBVZDNSA-N |
| XLogP | 3.20 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|