C19H28N4O3S — CID 72883876
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(5-propylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)ethanone (PubChem CID 72883876) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(5-propylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)ethanone.
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(5-propylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)ethanone |
|---|---|
| PubChem CID | 72883876 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(5-propylspiro[6,7-dihydro-1H-imidazo[4,5-c]pyridine-4,4'-piperidine]-1'-yl)ethanone |
| SMILES | CCCN1CCc2[nH]cnc2C12CCN(C(=O)CC1C=CS(=O)(=O)C1)CC2 |
| InChI | InChI=1S/C19H28N4O3S/c1-2-7-23-8-3-16-18(21-14-20-16)19(23)5-9-22(10-6-19)17(24)12-15-4-11-27(25,26)13-15/h4,11,14-15H,2-3,5-10,12-13H2,1H3,(H,20,21) |
| InChIKey | IBRPSWLIUBESHH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |