C14H22N4O5S — CID 72884487
(3aR,6aR)-5-(1-ethylpyrazol-4-yl)sulfonyl-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72884487) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is (3aR,6aR)-5-(1-ethylpyrazol-4-yl)sulfonyl-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-(1-ethylpyrazol-4-yl)sulfonyl-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72884487 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (3aR,6aR)-5-(1-ethylpyrazol-4-yl)sulfonyl-2-(2-hydroxyethyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)N2C[C@H]3CN(CCO)C[C@@]3(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C14H22N4O5S/c1-2-17-8-12(5-15-17)24(22,23)18-7-11-6-16(3-4-19)9-14(11,10-18)13(20)21/h5,8,11,19H,2-4,6-7,9-10H2,1H3,(H,20,21)/t11-,14-/m1/s1 |
| InChIKey | XVHMNFKHHQLQMG-BXUZGUMPSA-N |
| XLogP | -1.10 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |