About 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol
2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol (PubChem CID 72885248) has the molecular formula C17H15F3N4O
and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol |
| PubChem CID | 72885248 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol |
| SMILES | Cc1nc(NCC(O)c2ccccc2C(F)(F)F)c2cccnc2n1 |
| InChI | InChI=1S/C17H15F3N4O/c1-10-23-15-12(6-4-8-21-15)16(24-10)22-9-14(25)11-5-2-3-7-13(11)17(18,19)20/h2-8,14,25H,9H2,1H3,(H,21,22,23,24) |
| InChIKey | XFHDTUQHNQKYCQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol?
The IUPAC name of 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol (CID 72885248) is 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol.
What is the SMILES notation for 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol?
The canonical SMILES for 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol is Cc1nc(NCC(O)c2ccccc2C(F)(F)F)c2cccnc2n1.
What is the InChIKey of 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol?
The InChIKey is XFHDTUQHNQKYCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O/c1-10-23-15-12(6-4-8-21-15)16(24-10)22-9-14(25)11-5-2-3-7-13(11)17(18,19)20/h2-8,14,25H,9H2,1H3,(H,21,22,23,24).
What are the key properties of 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol?
2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol has a molecular weight of 348.33 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylpyrido[2,3-d]pyrimidin-4-yl)amino]-1-[2-(trifluoromethyl)phenyl]ethanol is sourced from PubChem (CID 72885248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).