C17H23N7O — CID 72885362
N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 72885362) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 72885362 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | N-[1-[4-(3-methoxypropyl)-1,2,4-triazol-3-yl]ethyl]-5,7-dimethylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | COCCCn1cnnc1C(C)Nc1ncnc2nc(C)cc(C)c12 |
| InChI | InChI=1S/C17H23N7O/c1-11-8-12(2)21-15-14(11)16(19-9-18-15)22-13(3)17-23-20-10-24(17)6-5-7-25-4/h8-10,13H,5-7H2,1-4H3,(H,18,19,21,22) |
| InChIKey | AALTZUJHXIDMQZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|