C19H20N4O5 — CID 72885713
4-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]benzamide (PubChem CID 72885713) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]benzamide.
| Compound Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 72885713 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-(2,4-dioxoimidazolidin-1-yl)-N-[(3R,4S)-4-[(3-methyl-1,2-oxazol-5-yl)methyl]oxolan-3-yl]benzamide |
| SMILES | Cc1cc(C[C@@H]2COC[C@@H]2NC(=O)c2ccc(N3CC(=O)NC3=O)cc2)on1 |
| InChI | InChI=1S/C19H20N4O5/c1-11-6-15(28-22-11)7-13-9-27-10-16(13)20-18(25)12-2-4-14(5-3-12)23-8-17(24)21-19(23)26/h2-6,13,16H,7-10H2,1H3,(H,20,25)(H,21,24,26)/t13-,16+/m1/s1 |
| InChIKey | YJXPBIVPQGDLPP-CJNGLKHVSA-N |
| XLogP | 1.03 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|