C15H16N4O3S2 — CID 72885859
1-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-(3-oxo-1H-2-benzofuran-5-yl)urea (PubChem CID 72885859) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-(3-oxo-1H-2-benzofuran-5-yl)urea.
| Compound Name | 1-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-(3-oxo-1H-2-benzofuran-5-yl)urea |
|---|---|
| PubChem CID | 72885859 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-3-(3-oxo-1H-2-benzofuran-5-yl)urea |
| SMILES | Cc1nnc(SCCCNC(=O)Nc2ccc3c(c2)C(=O)OC3)s1 |
| InChI | InChI=1S/C15H16N4O3S2/c1-9-18-19-15(24-9)23-6-2-5-16-14(21)17-11-4-3-10-8-22-13(20)12(10)7-11/h3-4,7H,2,5-6,8H2,1H3,(H2,16,17,21) |
| InChIKey | RTULZTVZNQVYIK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|