About 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol
2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol (PubChem CID 72886104) has the molecular formula C12H24N4O2
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol |
| PubChem CID | 72886104 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol |
| SMILES | COCCc1nc(CC(C)N(C)C)n(CCO)n1 |
| InChI | InChI=1S/C12H24N4O2/c1-10(15(2)3)9-12-13-11(5-8-18-4)14-16(12)6-7-17/h10,17H,5-9H2,1-4H3 |
| InChIKey | JKYNIFFUITUUND-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol?
The IUPAC name of 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol (CID 72886104) is 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol?
The canonical SMILES for 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol is COCCc1nc(CC(C)N(C)C)n(CCO)n1.
What is the InChIKey of 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol?
The InChIKey is JKYNIFFUITUUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4O2/c1-10(15(2)3)9-12-13-11(5-8-18-4)14-16(12)6-7-17/h10,17H,5-9H2,1-4H3.
What are the key properties of 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol?
2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol has a molecular weight of 256.35 g/mol, XLogP of -0.05, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-(dimethylamino)propyl]-3-(2-methoxyethyl)-1,2,4-triazol-1-yl]ethanol is sourced from PubChem (CID 72886104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).