About 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea (PubChem CID 728866) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea.
Molecular Properties
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea |
| PubChem CID | 728866 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea |
| SMILES | COc1ccc(CCNC(=S)Nc2ccccc2C)cc1OC |
| InChI | InChI=1S/C18H22N2O2S/c1-13-6-4-5-7-15(13)20-18(23)19-11-10-14-8-9-16(21-2)17(12-14)22-3/h4-9,12H,10-11H2,1-3H3,(H2,19,20,23) |
| InChIKey | BNBSMOGECBEFOJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea?
The IUPAC name of 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea (CID 728866) is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea.
What is the SMILES notation for 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea?
The canonical SMILES for 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea is COc1ccc(CCNC(=S)Nc2ccccc2C)cc1OC.
What is the InChIKey of 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea?
The InChIKey is BNBSMOGECBEFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c1-13-6-4-5-7-15(13)20-18(23)19-11-10-14-8-9-16(21-2)17(12-14)22-3/h4-9,12H,10-11H2,1-3H3,(H2,19,20,23).
What are the key properties of 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea?
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea has a molecular weight of 330.45 g/mol, XLogP of 3.54, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2-methylphenyl)thiourea is sourced from PubChem (CID 728866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).