C14H23N3O2 — CID 72887191
[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone (PubChem CID 72887191) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone.
| Compound Name | [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 72887191 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | [(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-(5-methyl-1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1ncc(C(=O)N2CCC[C@H]2COC)c1C |
| InChI | InChI=1S/C14H23N3O2/c1-4-7-17-11(2)13(9-15-17)14(18)16-8-5-6-12(16)10-19-3/h9,12H,4-8,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | JVFSKKIICBCYOV-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |