C13H20N4O2 — CID 72887627
5-morpholin-4-yl-2-(pyrrolidin-3-ylmethyl)pyridazin-3-one (PubChem CID 72887627) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-morpholin-4-yl-2-(pyrrolidin-3-ylmethyl)pyridazin-3-one.
| Compound Name | 5-morpholin-4-yl-2-(pyrrolidin-3-ylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 72887627 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-morpholin-4-yl-2-(pyrrolidin-3-ylmethyl)pyridazin-3-one |
| SMILES | O=c1cc(N2CCOCC2)cnn1CC1CCNC1 |
| InChI | InChI=1S/C13H20N4O2/c18-13-7-12(16-3-5-19-6-4-16)9-15-17(13)10-11-1-2-14-8-11/h7,9,11,14H,1-6,8,10H2 |
| InChIKey | NTVPUNPMCXVNIV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |