C13H18N4OS — CID 72887902
5-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1,3,4-oxadiazol-2-amine (PubChem CID 72887902) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 72887902 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-cyclopropyl-N-[3-(4,5-dimethyl-1,3-thiazol-2-yl)propyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Cc1nc(CCCNc2nnc(C3CC3)o2)sc1C |
| InChI | InChI=1S/C13H18N4OS/c1-8-9(2)19-11(15-8)4-3-7-14-13-17-16-12(18-13)10-5-6-10/h10H,3-7H2,1-2H3,(H,14,17) |
| InChIKey | UYYIMTZLAICBGW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|