C15H22ClN3O2S2 — CID 72888808
(2S,4R)-4-[(3-chlorothiophene-2-carbonyl)amino]-N-methyl-1-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide (PubChem CID 72888808) has the molecular formula C15H22ClN3O2S2 and a molecular weight of 375.95 g/mol. Its IUPAC name is (2S,4R)-4-[(3-chlorothiophene-2-carbonyl)amino]-N-methyl-1-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[(3-chlorothiophene-2-carbonyl)amino]-N-methyl-1-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 72888808 |
| Molecular Formula | C15H22ClN3O2S2 |
| Molecular Weight | 375.95 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2S,4R)-4-[(3-chlorothiophene-2-carbonyl)amino]-N-methyl-1-(3-methylsulfanylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@@H](NC(=O)c2sccc2Cl)CN1CCCSC |
| InChI | InChI=1S/C15H22ClN3O2S2/c1-17-14(20)12-8-10(9-19(12)5-3-6-22-2)18-15(21)13-11(16)4-7-23-13/h4,7,10,12H,3,5-6,8-9H2,1-2H3,(H,17,20)(H,18,21)/t10-,12+/m1/s1 |
| InChIKey | HCNQDSXYJCLGKP-PWSUYJOCSA-N |
| XLogP | 2.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.95 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|