C18H30N4O3 — CID 72889407
2-[2-(2-ethylbutylamino)-4-morpholin-4-ylpyrimidin-5-yl]-2-methylpropanoic acid (PubChem CID 72889407) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[2-(2-ethylbutylamino)-4-morpholin-4-ylpyrimidin-5-yl]-2-methylpropanoic acid.
| Compound Name | 2-[2-(2-ethylbutylamino)-4-morpholin-4-ylpyrimidin-5-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 72889407 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-[2-(2-ethylbutylamino)-4-morpholin-4-ylpyrimidin-5-yl]-2-methylpropanoic acid |
| SMILES | CCC(CC)CNc1ncc(C(C)(C)C(=O)O)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H30N4O3/c1-5-13(6-2)11-19-17-20-12-14(18(3,4)16(23)24)15(21-17)22-7-9-25-10-8-22/h12-13H,5-11H2,1-4H3,(H,23,24)(H,19,20,21) |
| InChIKey | WXUXEIQSSIYWIC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |