C26H34N2O3 — CID 7288984
N-[2-(1-adamantyl)ethyl]-N-[(3R)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 7288984) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-N-[(3R)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-N-[(3R)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 7288984 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-N-[(3R)-1-(2,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)N(CCC12CC3CC(CC(C3)C1)C2)[C@@H]1CC(=O)N(c2ccc(C)cc2C)C1=O |
| InChI | InChI=1S/C26H34N2O3/c1-16-4-5-22(17(2)8-16)28-24(30)12-23(25(28)31)27(18(3)29)7-6-26-13-19-9-20(14-26)11-21(10-19)15-26/h4-5,8,19-21,23H,6-7,9-15H2,1-3H3/t19?,20?,21?,23-,26?/m1/s1 |
| InChIKey | VELNTVLIYXVBNB-OJNXCIKNSA-N |
| XLogP | 4.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|