C15H18F3N7 — CID 72890026
3-methyl-5-[1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazol-5-yl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole (PubChem CID 72890026) has the molecular formula C15H18F3N7 and a molecular weight of 353.35 g/mol. Its IUPAC name is 3-methyl-5-[1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazol-5-yl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole.
| Compound Name | 3-methyl-5-[1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazol-5-yl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 72890026 |
| Molecular Formula | C15H18F3N7 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-methyl-5-[1-methyl-3-(1,3,5-trimethylpyrazol-4-yl)pyrazol-5-yl]-1-(2,2,2-trifluoroethyl)-1,2,4-triazole |
| SMILES | Cc1nc(-c2cc(-c3c(C)nn(C)c3C)nn2C)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C15H18F3N7/c1-8-13(9(2)23(4)20-8)11-6-12(24(5)22-11)14-19-10(3)21-25(14)7-15(16,17)18/h6H,7H2,1-5H3 |
| InChIKey | KBOCDWVVNXTNLT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |