About 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one
8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one (PubChem CID 72890852) has the molecular formula C15H14FN3OS
and a molecular weight of 303.36 g/mol. Its IUPAC name is 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one |
| PubChem CID | 72890852 |
| Molecular Formula | C15H14FN3OS |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one |
| SMILES | O=c1cc(CNCCc2nccs2)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C15H14FN3OS/c16-12-3-1-2-11-13(20)8-10(19-15(11)12)9-17-5-4-14-18-6-7-21-14/h1-3,6-8,17H,4-5,9H2,(H,19,20) |
| InChIKey | VUSWDIUBHOAYTF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one?
The IUPAC name of 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one (CID 72890852) is 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one.
What is the SMILES notation for 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one?
The canonical SMILES for 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one is O=c1cc(CNCCc2nccs2)[nH]c2c(F)cccc12.
What is the InChIKey of 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one?
The InChIKey is VUSWDIUBHOAYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN3OS/c16-12-3-1-2-11-13(20)8-10(19-15(11)12)9-17-5-4-14-18-6-7-21-14/h1-3,6-8,17H,4-5,9H2,(H,19,20).
What are the key properties of 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one?
8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one has a molecular weight of 303.36 g/mol, XLogP of 2.46, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-[[2-(1,3-thiazol-2-yl)ethylamino]methyl]-1H-quinolin-4-one is sourced from PubChem (CID 72890852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).