C21H30N4O — CID 72890881
2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-di(propan-2-yl)benzamide (PubChem CID 72890881) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 72890881 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1ccccc1-c1n[nH]c(C2CCCCC2)n1)C(C)C |
| InChI | InChI=1S/C21H30N4O/c1-14(2)25(15(3)4)21(26)18-13-9-8-12-17(18)20-22-19(23-24-20)16-10-6-5-7-11-16/h8-9,12-16H,5-7,10-11H2,1-4H3,(H,22,23,24) |
| InChIKey | STAGBSAIVSAHJW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |