About (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol
(1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol (PubChem CID 72891186) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol.
Molecular Properties
| Compound Name | (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol |
| PubChem CID | 72891186 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol |
| SMILES | CCc1nc(N2CCC3(CC2)[C@H](O)C[C@@H]3O)ncc1C |
| InChI | InChI=1S/C15H23N3O2/c1-3-11-10(2)9-16-14(17-11)18-6-4-15(5-7-18)12(19)8-13(15)20/h9,12-13,19-20H,3-8H2,1-2H3/t12-,13+ |
| InChIKey | ZLJHGMPUZKCCCW-BETUJISGSA-N |
| XLogP | 1.06 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol?
The IUPAC name of (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol (CID 72891186) is (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol.
What is the SMILES notation for (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol?
The canonical SMILES for (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol is CCc1nc(N2CCC3(CC2)[C@H](O)C[C@@H]3O)ncc1C.
What is the InChIKey of (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol?
The InChIKey is ZLJHGMPUZKCCCW-BETUJISGSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-3-11-10(2)9-16-14(17-11)18-6-4-15(5-7-18)12(19)8-13(15)20/h9,12-13,19-20H,3-8H2,1-2H3/t12-,13+.
What are the key properties of (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol?
(1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol has a molecular weight of 277.37 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-7-(4-ethyl-5-methylpyrimidin-2-yl)-7-azaspiro[3.5]nonane-1,3-diol is sourced from PubChem (CID 72891186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).