About 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol
2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol (PubChem CID 72892135) has the molecular formula C12H26N2O4S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol |
| PubChem CID | 72892135 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol |
| SMILES | CCCS(=O)(=O)N1C[C@@H](CN(C)CCO)[C@@H](CO)C1 |
| InChI | InChI=1S/C12H26N2O4S/c1-3-6-19(17,18)14-8-11(12(9-14)10-16)7-13(2)4-5-15/h11-12,15-16H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | ZPLDEQSUURULFH-VXGBXAGGSA-N |
| XLogP | -0.81 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol?
The IUPAC name of 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol (CID 72892135) is 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol.
What is the SMILES notation for 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol?
The canonical SMILES for 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol is CCCS(=O)(=O)N1C[C@@H](CN(C)CCO)[C@@H](CO)C1.
What is the InChIKey of 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol?
The InChIKey is ZPLDEQSUURULFH-VXGBXAGGSA-N. The full InChI is InChI=1S/C12H26N2O4S/c1-3-6-19(17,18)14-8-11(12(9-14)10-16)7-13(2)4-5-15/h11-12,15-16H,3-10H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol?
2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol has a molecular weight of 294.42 g/mol, XLogP of -0.81, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R,4R)-4-(hydroxymethyl)-1-propylsulfonylpyrrolidin-3-yl]methyl-methylamino]ethanol is sourced from PubChem (CID 72892135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).