About (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol
(3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol (PubChem CID 72892335) has the molecular formula C11H22N2O3S
and a molecular weight of 262.37 g/mol. Its IUPAC name is (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol |
| PubChem CID | 72892335 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol |
| SMILES | CC1(C)CN(S(=O)(=O)N2CCCC2)C[C@]1(C)O |
| InChI | InChI=1S/C11H22N2O3S/c1-10(2)8-13(9-11(10,3)14)17(15,16)12-6-4-5-7-12/h14H,4-9H2,1-3H3/t11-/m0/s1 |
| InChIKey | GWWTVACVMRHKPK-NSHDSACASA-N |
| XLogP | 0.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol?
The IUPAC name of (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol (CID 72892335) is (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol.
What is the SMILES notation for (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol?
The canonical SMILES for (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol is CC1(C)CN(S(=O)(=O)N2CCCC2)C[C@]1(C)O.
What is the InChIKey of (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol?
The InChIKey is GWWTVACVMRHKPK-NSHDSACASA-N. The full InChI is InChI=1S/C11H22N2O3S/c1-10(2)8-13(9-11(10,3)14)17(15,16)12-6-4-5-7-12/h14H,4-9H2,1-3H3/t11-/m0/s1.
What are the key properties of (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol?
(3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol has a molecular weight of 262.37 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,4,4-trimethyl-1-pyrrolidin-1-ylsulfonylpyrrolidin-3-ol is sourced from PubChem (CID 72892335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).