C11H12F3N5S2 — CID 72892782
N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 72892782) has the molecular formula C11H12F3N5S2 and a molecular weight of 335.38 g/mol. Its IUPAC name is N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 72892782 |
| Molecular Formula | C11H12F3N5S2 |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]-2-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1nnc(SCCCNc2ccnc(C(F)(F)F)n2)s1 |
| InChI | InChI=1S/C11H12F3N5S2/c1-7-18-19-10(21-7)20-6-2-4-15-8-3-5-16-9(17-8)11(12,13)14/h3,5H,2,4,6H2,1H3,(H,15,16,17) |
| InChIKey | BKOTUFQXGCYLAB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|