About N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine
N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine (PubChem CID 72892795) has the molecular formula C15H26N4
and a molecular weight of 262.40 g/mol. Its IUPAC name is N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine |
| PubChem CID | 72892795 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine |
| SMILES | Cc1ncnc(NCCCN(C)C2CCCC2)c1C |
| InChI | InChI=1S/C15H26N4/c1-12-13(2)17-11-18-15(12)16-9-6-10-19(3)14-7-4-5-8-14/h11,14H,4-10H2,1-3H3,(H,16,17,18) |
| InChIKey | CXTGCXOAZBYEFM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine?
The IUPAC name of N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine (CID 72892795) is N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine.
What is the SMILES notation for N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine?
The canonical SMILES for N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine is Cc1ncnc(NCCCN(C)C2CCCC2)c1C.
What is the InChIKey of N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine?
The InChIKey is CXTGCXOAZBYEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4/c1-12-13(2)17-11-18-15(12)16-9-6-10-19(3)14-7-4-5-8-14/h11,14H,4-10H2,1-3H3,(H,16,17,18).
What are the key properties of N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine?
N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine has a molecular weight of 262.40 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N-(5,6-dimethylpyrimidin-4-yl)-N'-methylpropane-1,3-diamine is sourced from PubChem (CID 72892795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).