C15H19NO4 — CID 72893219
5,5-dimethyl-3-(4-phenoxybutyl)-1,3-oxazolidine-2,4-dione (PubChem CID 72893219) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-phenoxybutyl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-(4-phenoxybutyl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 72893219 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 5,5-dimethyl-3-(4-phenoxybutyl)-1,3-oxazolidine-2,4-dione |
| SMILES | CC1(C)OC(=O)N(CCCCOc2ccccc2)C1=O |
| InChI | InChI=1S/C15H19NO4/c1-15(2)13(17)16(14(18)20-15)10-6-7-11-19-12-8-4-3-5-9-12/h3-5,8-9H,6-7,10-11H2,1-2H3 |
| InChIKey | YQUNGAOSSZDAJF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|