C21H21N7 — CID 72893393
(3R)-3-[2-benzyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydroisoquinoline (PubChem CID 72893393) has the molecular formula C21H21N7 and a molecular weight of 371.45 g/mol. Its IUPAC name is (3R)-3-[2-benzyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3R)-3-[2-benzyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 72893393 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (3R)-3-[2-benzyl-5-(1,2,4-triazol-1-ylmethyl)-1,2,4-triazol-3-yl]-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc(Cn2nc(Cn3cncn3)nc2[C@H]2Cc3ccccc3CN2)cc1 |
| InChI | InChI=1S/C21H21N7/c1-2-6-16(7-3-1)12-28-21(25-20(26-28)13-27-15-22-14-24-27)19-10-17-8-4-5-9-18(17)11-23-19/h1-9,14-15,19,23H,10-13H2/t19-/m1/s1 |
| InChIKey | MROLPDRLWUXEIR-LJQANCHMSA-N |
| XLogP | 2.35 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |