C19H26N2O3 — CID 72894051
(3aS,7aR)-5-methyl-2-(4-phenylbutanoyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid (PubChem CID 72894051) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3aS,7aR)-5-methyl-2-(4-phenylbutanoyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid.
| Compound Name | (3aS,7aR)-5-methyl-2-(4-phenylbutanoyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
|---|---|
| PubChem CID | 72894051 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3aS,7aR)-5-methyl-2-(4-phenylbutanoyl)-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridine-3a-carboxylic acid |
| SMILES | CN1CC[C@H]2CN(C(=O)CCCc3ccccc3)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H26N2O3/c1-20-11-10-16-12-21(14-19(16,13-20)18(23)24)17(22)9-5-8-15-6-3-2-4-7-15/h2-4,6-7,16H,5,8-14H2,1H3,(H,23,24)/t16-,19-/m0/s1 |
| InChIKey | KIGGPXPYSUOZHO-LPHOPBHVSA-N |
| XLogP | 1.87 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |