About (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine
(3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine (PubChem CID 72894110) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine |
| PubChem CID | 72894110 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine |
| SMILES | Cc1nccnc1N1C[C@H](C(C)C)[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C14H24N4/c1-10(2)12-8-18(9-13(12)17(4)5)14-11(3)15-6-7-16-14/h6-7,10,12-13H,8-9H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | MNXZVQTWXQJKTC-OLZOCXBDSA-N |
| XLogP | 1.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine?
The IUPAC name of (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine (CID 72894110) is (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine.
What is the SMILES notation for (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine?
The canonical SMILES for (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine is Cc1nccnc1N1C[C@H](C(C)C)[C@@H](N(C)C)C1.
What is the InChIKey of (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine?
The InChIKey is MNXZVQTWXQJKTC-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H24N4/c1-10(2)12-8-18(9-13(12)17(4)5)14-11(3)15-6-7-16-14/h6-7,10,12-13H,8-9H2,1-5H3/t12-,13+/m1/s1.
What are the key properties of (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine?
(3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine has a molecular weight of 248.37 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-N,N-dimethyl-1-(3-methylpyrazin-2-yl)-4-propan-2-ylpyrrolidin-3-amine is sourced from PubChem (CID 72894110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).