About 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione
6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione (PubChem CID 72894274) has the molecular formula C15H14Cl2N4O3
and a molecular weight of 369.21 g/mol. Its IUPAC name is 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 72894274 |
| Molecular Formula | C15H14Cl2N4O3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H14Cl2N4O3/c16-10-2-1-9(7-11(10)17)20-3-5-21(6-4-20)14(23)12-8-13(22)19-15(24)18-12/h1-2,7-8H,3-6H2,(H2,18,19,22,24) |
| InChIKey | XREZIAMDGRLMGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione (CID 72894274) is 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione is O=C(c1cc(=O)[nH]c(=O)[nH]1)N1CCN(c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione?
The InChIKey is XREZIAMDGRLMGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N4O3/c16-10-2-1-9(7-11(10)17)20-3-5-21(6-4-20)14(23)12-8-13(22)19-15(24)18-12/h1-2,7-8H,3-6H2,(H2,18,19,22,24).
What are the key properties of 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione?
6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione has a molecular weight of 369.21 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 72894274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).