C14H24FN5O — CID 72894367
[1-[2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]ethyl]piperidin-3-yl]methanol (PubChem CID 72894367) has the molecular formula C14H24FN5O and a molecular weight of 297.38 g/mol. Its IUPAC name is [1-[2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]ethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]ethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 72894367 |
| Molecular Formula | C14H24FN5O |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | [1-[2-[[4-(dimethylamino)-5-fluoropyrimidin-2-yl]amino]ethyl]piperidin-3-yl]methanol |
| SMILES | CN(C)c1nc(NCCN2CCCC(CO)C2)ncc1F |
| InChI | InChI=1S/C14H24FN5O/c1-19(2)13-12(15)8-17-14(18-13)16-5-7-20-6-3-4-11(9-20)10-21/h8,11,21H,3-7,9-10H2,1-2H3,(H,16,17,18) |
| InChIKey | GUHDCONDVDADER-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |