C23H31N3O2 — CID 72894557
1-[3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone (PubChem CID 72894557) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-[3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 72894557 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[3-[1-(cyclobutylmethyl)imidazol-2-yl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCCC(c3nccn3CC3CCC3)C2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c1-2-28-21-10-8-18(9-11-21)15-22(27)25-13-4-7-20(17-25)23-24-12-14-26(23)16-19-5-3-6-19/h8-12,14,19-20H,2-7,13,15-17H2,1H3 |
| InChIKey | CZXFAEZXEUUSPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |