C13H22N2O4S — CID 72894845
(3aR,6aR)-2-(2-hydroxyethyl)-5-(3-methylsulfanylpropanoyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 72894845) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is (3aR,6aR)-2-(2-hydroxyethyl)-5-(3-methylsulfanylpropanoyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-2-(2-hydroxyethyl)-5-(3-methylsulfanylpropanoyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 72894845 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (3aR,6aR)-2-(2-hydroxyethyl)-5-(3-methylsulfanylpropanoyl)-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | CSCCC(=O)N1C[C@H]2CN(CCO)C[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C13H22N2O4S/c1-20-5-2-11(17)15-7-10-6-14(3-4-16)8-13(10,9-15)12(18)19/h10,16H,2-9H2,1H3,(H,18,19)/t10-,13-/m1/s1 |
| InChIKey | XAILBJAGYOKFLL-ZWNOBZJWSA-N |
| XLogP | -0.42 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |