C19H15F4N3O2 — CID 72895193
N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide (PubChem CID 72895193) has the molecular formula C19H15F4N3O2 and a molecular weight of 393.34 g/mol. Its IUPAC name is N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide.
| Compound Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
|---|---|
| PubChem CID | 72895193 |
| Molecular Formula | C19H15F4N3O2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[[2-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-(3-oxo-4H-quinoxalin-2-yl)propanamide |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)NCc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C19H15F4N3O2/c20-13-9-12(19(21,22)23)6-5-11(13)10-24-17(27)8-7-16-18(28)26-15-4-2-1-3-14(15)25-16/h1-6,9H,7-8,10H2,(H,24,27)(H,26,28) |
| InChIKey | JJAOECVVZZBTBB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |