About 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate
2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate (PubChem CID 7289553) has the molecular formula C11H15N2O4-
and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate.
Molecular Properties
| Compound Name | 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate |
| PubChem CID | 7289553 |
| Molecular Formula | C11H15N2O4- |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate |
| SMILES | CCOc1nc(C)c(CC(=O)[O-])c(OCC)n1 |
| InChI | InChI=1S/C11H16N2O4/c1-4-16-10-8(6-9(14)15)7(3)12-11(13-10)17-5-2/h4-6H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | FHNYGYRFWUNOGY-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 84.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate?
The IUPAC name of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate (CID 7289553) is 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate.
What is the SMILES notation for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate?
The canonical SMILES for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate is CCOc1nc(C)c(CC(=O)[O-])c(OCC)n1.
What is the InChIKey of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate?
The InChIKey is FHNYGYRFWUNOGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H16N2O4/c1-4-16-10-8(6-9(14)15)7(3)12-11(13-10)17-5-2/h4-6H2,1-3H3,(H,14,15)/p-1.
What are the key properties of 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate?
2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate has a molecular weight of 239.25 g/mol, XLogP of -0.13, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-diethoxy-6-methylpyrimidin-5-yl)acetate is sourced from PubChem (CID 7289553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).