C17H23N5O2 — CID 72895619
4-methoxy-6-[4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]pyrimidin-2-amine (PubChem CID 72895619) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 4-methoxy-6-[4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-6-[4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 72895619 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-methoxy-6-[4-(4-methoxyphenyl)-2-methylpiperazin-1-yl]pyrimidin-2-amine |
| SMILES | COc1ccc(N2CCN(c3cc(OC)nc(N)n3)C(C)C2)cc1 |
| InChI | InChI=1S/C17H23N5O2/c1-12-11-21(13-4-6-14(23-2)7-5-13)8-9-22(12)15-10-16(24-3)20-17(18)19-15/h4-7,10,12H,8-9,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | GXGYWPBXYOAYDJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|