C19H21N5O3 — CID 72895809
1-[4-[3-(3,5-dimethylpyrazol-1-yl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 72895809) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-[4-[3-(3,5-dimethylpyrazol-1-yl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-[4-[3-(3,5-dimethylpyrazol-1-yl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 72895809 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-[4-[3-(3,5-dimethylpyrazol-1-yl)pyrrolidine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(C)n(C2CCN(C(=O)c3ccc(N4CC(=O)NC4=O)cc3)C2)n1 |
| InChI | InChI=1S/C19H21N5O3/c1-12-9-13(2)24(21-12)16-7-8-22(10-16)18(26)14-3-5-15(6-4-14)23-11-17(25)20-19(23)27/h3-6,9,16H,7-8,10-11H2,1-2H3,(H,20,25,27) |
| InChIKey | IGMZCWLTQIKCQP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|